C11H23NO2 — CID 77073747
3-[(2-methylcycloheptyl)amino]propane-1,2-diol (PubChem CID 77073747) has the molecular formula C11H23NO2 and a molecular weight of 201.31 g/mol. Its IUPAC name is 3-[(2-methylcycloheptyl)amino]propane-1,2-diol.
| Compound Name | 3-[(2-methylcycloheptyl)amino]propane-1,2-diol |
|---|---|
| PubChem CID | 77073747 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | 3-[(2-methylcycloheptyl)amino]propane-1,2-diol |
| SMILES | CC1CCCCCC1NCC(O)CO |
| InChI | InChI=1S/C11H23NO2/c1-9-5-3-2-4-6-11(9)12-7-10(14)8-13/h9-14H,2-8H2,1H3 |
| InChIKey | ULAYCLCYVQPPPF-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |