C10H22N2O2 — CID 104931127
(2S)-3-[(1,3-dimethylpiperidin-4-yl)amino]propane-1,2-diol (PubChem CID 104931127) has the molecular formula C10H22N2O2 and a molecular weight of 202.30 g/mol. Its IUPAC name is (2S)-3-[(1,3-dimethylpiperidin-4-yl)amino]propane-1,2-diol.
| Compound Name | (2S)-3-[(1,3-dimethylpiperidin-4-yl)amino]propane-1,2-diol |
|---|---|
| PubChem CID | 104931127 |
| Molecular Formula | C10H22N2O2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | (2S)-3-[(1,3-dimethylpiperidin-4-yl)amino]propane-1,2-diol |
| SMILES | CC1CN(C)CCC1NC[C@H](O)CO |
| InChI | InChI=1S/C10H22N2O2/c1-8-6-12(2)4-3-10(8)11-5-9(14)7-13/h8-11,13-14H,3-7H2,1-2H3/t8?,9-,10?/m0/s1 |
| InChIKey | YJCGSQKDIKKQHT-KYHHOPLUSA-N |
| XLogP | -0.73 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |