C9H20N2O — CID 115707421
2-[(1,3-dimethylpiperidin-4-yl)amino]ethanol (PubChem CID 115707421) has the molecular formula C9H20N2O and a molecular weight of 172.27 g/mol. Its IUPAC name is 2-[(1,3-dimethylpiperidin-4-yl)amino]ethanol.
| Compound Name | 2-[(1,3-dimethylpiperidin-4-yl)amino]ethanol |
|---|---|
| PubChem CID | 115707421 |
| Molecular Formula | C9H20N2O |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | 2-[(1,3-dimethylpiperidin-4-yl)amino]ethanol |
| SMILES | CC1CN(C)CCC1NCCO |
| InChI | InChI=1S/C9H20N2O/c1-8-7-11(2)5-3-9(8)10-4-6-12/h8-10,12H,3-7H2,1-2H3 |
| InChIKey | LWQVFCWKOZFPHN-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |