C10H22N2O — CID 103906380
(2S)-1-[(1,3-dimethylpiperidin-4-yl)amino]propan-2-ol (PubChem CID 103906380) has the molecular formula C10H22N2O and a molecular weight of 186.30 g/mol. Its IUPAC name is (2S)-1-[(1,3-dimethylpiperidin-4-yl)amino]propan-2-ol.
| Compound Name | (2S)-1-[(1,3-dimethylpiperidin-4-yl)amino]propan-2-ol |
|---|---|
| PubChem CID | 103906380 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | (2S)-1-[(1,3-dimethylpiperidin-4-yl)amino]propan-2-ol |
| SMILES | CC1CN(C)CCC1NC[C@H](C)O |
| InChI | InChI=1S/C10H22N2O/c1-8-7-12(3)5-4-10(8)11-6-9(2)13/h8-11,13H,4-7H2,1-3H3/t8?,9-,10?/m0/s1 |
| InChIKey | APNXREAMJZQCEI-KYHHOPLUSA-N |
| XLogP | 0.30 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |