C11H21BrN2O2 — CID 103268568
methyl 2-bromo-3-[(1,3-dimethylpiperidin-4-yl)amino]propanoate (PubChem CID 103268568) has the molecular formula C11H21BrN2O2 and a molecular weight of 293.20 g/mol. Its IUPAC name is methyl 2-bromo-3-[(1,3-dimethylpiperidin-4-yl)amino]propanoate.
| Compound Name | methyl 2-bromo-3-[(1,3-dimethylpiperidin-4-yl)amino]propanoate |
|---|---|
| PubChem CID | 103268568 |
| Molecular Formula | C11H21BrN2O2 |
| Molecular Weight | 293.20 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | methyl 2-bromo-3-[(1,3-dimethylpiperidin-4-yl)amino]propanoate |
| SMILES | COC(=O)C(Br)CNC1CCN(C)CC1C |
| InChI | InChI=1S/C11H21BrN2O2/c1-8-7-14(2)5-4-10(8)13-6-9(12)11(15)16-3/h8-10,13H,4-7H2,1-3H3 |
| InChIKey | AFDJBYSNDRTLJT-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.20 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|