C12H24N2O2 — CID 114503255
methyl 2-[(1,3-dimethylpiperidin-4-yl)amino]butanoate (PubChem CID 114503255) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is methyl 2-[(1,3-dimethylpiperidin-4-yl)amino]butanoate.
| Compound Name | methyl 2-[(1,3-dimethylpiperidin-4-yl)amino]butanoate |
|---|---|
| PubChem CID | 114503255 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | methyl 2-[(1,3-dimethylpiperidin-4-yl)amino]butanoate |
| SMILES | CCC(NC1CCN(C)CC1C)C(=O)OC |
| InChI | InChI=1S/C12H24N2O2/c1-5-10(12(15)16-4)13-11-6-7-14(3)8-9(11)2/h9-11,13H,5-8H2,1-4H3 |
| InChIKey | GFPMPEFGFDMWJL-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |