C10H20N2O3 — CID 114506096
2-hydroxyethyl N-(1,3-dimethylpiperidin-4-yl)carbamate (PubChem CID 114506096) has the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. Its IUPAC name is 2-hydroxyethyl N-(1,3-dimethylpiperidin-4-yl)carbamate.
| Compound Name | 2-hydroxyethyl N-(1,3-dimethylpiperidin-4-yl)carbamate |
|---|---|
| PubChem CID | 114506096 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 2-hydroxyethyl N-(1,3-dimethylpiperidin-4-yl)carbamate |
| SMILES | CC1CN(C)CCC1NC(=O)OCCO |
| InChI | InChI=1S/C10H20N2O3/c1-8-7-12(2)4-3-9(8)11-10(14)15-6-5-13/h8-9,13H,3-7H2,1-2H3,(H,11,14) |
| InChIKey | UOZGZKDEHWQFPD-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |