C11H21N3S — CID 115598623
1-cyclopropyl-3-(1,3-dimethylpiperidin-4-yl)thiourea (PubChem CID 115598623) has the molecular formula C11H21N3S and a molecular weight of 227.38 g/mol. Its IUPAC name is 1-cyclopropyl-3-(1,3-dimethylpiperidin-4-yl)thiourea.
| Compound Name | 1-cyclopropyl-3-(1,3-dimethylpiperidin-4-yl)thiourea |
|---|---|
| PubChem CID | 115598623 |
| Molecular Formula | C11H21N3S |
| Molecular Weight | 227.38 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 1-cyclopropyl-3-(1,3-dimethylpiperidin-4-yl)thiourea |
| SMILES | CC1CN(C)CCC1NC(=S)NC1CC1 |
| InChI | InChI=1S/C11H21N3S/c1-8-7-14(2)6-5-10(8)13-11(15)12-9-3-4-9/h8-10H,3-7H2,1-2H3,(H2,12,13,15) |
| InChIKey | QJUQXYKEXYYPEL-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.38 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|