C9H20N2O2Si — CID 59272029
2-tritritiosilylethyl N-(1,4-dimethylpyrrolidin-3-yl)carbamate (PubChem CID 59272029) has the molecular formula C9H20N2O2Si and a molecular weight of 222.38 g/mol. Its IUPAC name is 2-tritritiosilylethyl N-(1,4-dimethylpyrrolidin-3-yl)carbamate.
| Compound Name | 2-tritritiosilylethyl N-(1,4-dimethylpyrrolidin-3-yl)carbamate |
|---|---|
| PubChem CID | 59272029 |
| Molecular Formula | C9H20N2O2Si |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | 2-tritritiosilylethyl N-(1,4-dimethylpyrrolidin-3-yl)carbamate |
| SMILES | [3H][Si]([3H])([3H])CCOC(=O)NC1CN(C)CC1C |
| InChI | InChI=1S/C9H20N2O2Si/c1-7-5-11(2)6-8(7)10-9(12)13-3-4-14/h7-8H,3-6H2,1-2,14H3,(H,10,12)/i14T3 |
| InChIKey | ARXAKXJCTHSAOT-ZPHUVEBSSA-N |
| XLogP | -0.55 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|