About N-(cyclopropylmethyl)-1,4-dimethylpyrrolidin-3-amine
N-(cyclopropylmethyl)-1,4-dimethylpyrrolidin-3-amine (PubChem CID 131041729) has the molecular formula C10H20N2
and a molecular weight of 168.28 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-1,4-dimethylpyrrolidin-3-amine.
Analyze N-(cyclopropylmethyl)-1,4-dimethylpyrrolidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyclopropylmethyl)-1,4-dimethylpyrrolidin-3-amine?
The IUPAC name of N-(cyclopropylmethyl)-1,4-dimethylpyrrolidin-3-amine (CID 131041729) is N-(cyclopropylmethyl)-1,4-dimethylpyrrolidin-3-amine.
What is the SMILES notation for N-(cyclopropylmethyl)-1,4-dimethylpyrrolidin-3-amine?
The canonical SMILES for N-(cyclopropylmethyl)-1,4-dimethylpyrrolidin-3-amine is CC1CN(C)CC1NCC1CC1.
What is the InChIKey of N-(cyclopropylmethyl)-1,4-dimethylpyrrolidin-3-amine?
The InChIKey is CXESYNUBZYQVEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2/c1-8-6-12(2)7-10(8)11-5-9-3-4-9/h8-11H,3-7H2,1-2H3.
What are the key properties of N-(cyclopropylmethyl)-1,4-dimethylpyrrolidin-3-amine?
N-(cyclopropylmethyl)-1,4-dimethylpyrrolidin-3-amine has a molecular weight of 168.28 g/mol, XLogP of 0.94, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyclopropylmethyl)-1,4-dimethylpyrrolidin-3-amine is sourced from PubChem (CID 131041729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).