C12H24N2S2 — CID 115727339
N-(1,4-dithian-2-ylmethyl)-1,3-dimethylpiperidin-4-amine (PubChem CID 115727339) has the molecular formula C12H24N2S2 and a molecular weight of 260.47 g/mol. Its IUPAC name is N-(1,4-dithian-2-ylmethyl)-1,3-dimethylpiperidin-4-amine.
| Compound Name | N-(1,4-dithian-2-ylmethyl)-1,3-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 115727339 |
| Molecular Formula | C12H24N2S2 |
| Molecular Weight | 260.47 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | N-(1,4-dithian-2-ylmethyl)-1,3-dimethylpiperidin-4-amine |
| SMILES | CC1CN(C)CCC1NCC1CSCCS1 |
| InChI | InChI=1S/C12H24N2S2/c1-10-8-14(2)4-3-12(10)13-7-11-9-15-5-6-16-11/h10-13H,3-9H2,1-2H3 |
| InChIKey | ABGUXFTYZLPNIT-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.47 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |