C10H19ClN2 — CID 107900391
N-[(E)-3-chloroprop-2-enyl]-1,3-dimethylpiperidin-4-amine (PubChem CID 107900391) has the molecular formula C10H19ClN2 and a molecular weight of 202.73 g/mol. Its IUPAC name is N-[(E)-3-chloroprop-2-enyl]-1,3-dimethylpiperidin-4-amine.
| Compound Name | N-[(E)-3-chloroprop-2-enyl]-1,3-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 107900391 |
| Molecular Formula | C10H19ClN2 |
| Molecular Weight | 202.73 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | N-[(E)-3-chloroprop-2-enyl]-1,3-dimethylpiperidin-4-amine |
| SMILES | CC1CN(C)CCC1NC/C=C/Cl |
| InChI | InChI=1S/C10H19ClN2/c1-9-8-13(2)7-4-10(9)12-6-3-5-11/h3,5,9-10,12H,4,6-8H2,1-2H3/b5-3+ |
| InChIKey | VWBJVPDQUNRBJV-HWKANZROSA-N |
| XLogP | 1.67 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.73 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |