C11H22N2S2 — CID 115727317
N-(1,4-dithian-2-ylmethyl)-1-methylpiperidin-4-amine (PubChem CID 115727317) has the molecular formula C11H22N2S2 and a molecular weight of 246.44 g/mol. Its IUPAC name is N-(1,4-dithian-2-ylmethyl)-1-methylpiperidin-4-amine.
| Compound Name | N-(1,4-dithian-2-ylmethyl)-1-methylpiperidin-4-amine |
|---|---|
| PubChem CID | 115727317 |
| Molecular Formula | C11H22N2S2 |
| Molecular Weight | 246.44 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | N-(1,4-dithian-2-ylmethyl)-1-methylpiperidin-4-amine |
| SMILES | CN1CCC(NCC2CSCCS2)CC1 |
| InChI | InChI=1S/C11H22N2S2/c1-13-4-2-10(3-5-13)12-8-11-9-14-6-7-15-11/h10-12H,2-9H2,1H3 |
| InChIKey | RORSSJKNEUPQBC-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.44 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |