C11H19NS2 — CID 107908102
N-(1,4-dithian-2-ylmethyl)cyclohex-2-en-1-amine (PubChem CID 107908102) has the molecular formula C11H19NS2 and a molecular weight of 229.41 g/mol. Its IUPAC name is N-(1,4-dithian-2-ylmethyl)cyclohex-2-en-1-amine.
| Compound Name | N-(1,4-dithian-2-ylmethyl)cyclohex-2-en-1-amine |
|---|---|
| PubChem CID | 107908102 |
| Molecular Formula | C11H19NS2 |
| Molecular Weight | 229.41 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | N-(1,4-dithian-2-ylmethyl)cyclohex-2-en-1-amine |
| SMILES | C1=CC(NCC2CSCCS2)CCC1 |
| InChI | InChI=1S/C11H19NS2/c1-2-4-10(5-3-1)12-8-11-9-13-6-7-14-11/h2,4,10-12H,1,3,5-9H2 |
| InChIKey | BKRDXTWCTWCEQE-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.41 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|