C11H21NOS2 — CID 115886462
N-(1,4-dithian-2-ylmethyl)oxepan-4-amine (PubChem CID 115886462) has the molecular formula C11H21NOS2 and a molecular weight of 247.43 g/mol. Its IUPAC name is N-(1,4-dithian-2-ylmethyl)oxepan-4-amine.
| Compound Name | N-(1,4-dithian-2-ylmethyl)oxepan-4-amine |
|---|---|
| PubChem CID | 115886462 |
| Molecular Formula | C11H21NOS2 |
| Molecular Weight | 247.43 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | N-(1,4-dithian-2-ylmethyl)oxepan-4-amine |
| SMILES | C1COCCC(NCC2CSCCS2)C1 |
| InChI | InChI=1S/C11H21NOS2/c1-2-10(3-5-13-4-1)12-8-11-9-14-6-7-15-11/h10-12H,1-9H2 |
| InChIKey | MFBTVSNWRSKHSQ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.43 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |