C13H26N2O — CID 115708963
1,3-dimethyl-N-[2-(oxolan-2-yl)ethyl]piperidin-4-amine (PubChem CID 115708963) has the molecular formula C13H26N2O and a molecular weight of 226.36 g/mol. Its IUPAC name is 1,3-dimethyl-N-[2-(oxolan-2-yl)ethyl]piperidin-4-amine.
| Compound Name | 1,3-dimethyl-N-[2-(oxolan-2-yl)ethyl]piperidin-4-amine |
|---|---|
| PubChem CID | 115708963 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | 1,3-dimethyl-N-[2-(oxolan-2-yl)ethyl]piperidin-4-amine |
| SMILES | CC1CN(C)CCC1NCCC1CCCO1 |
| InChI | InChI=1S/C13H26N2O/c1-11-10-15(2)8-6-13(11)14-7-5-12-4-3-9-16-12/h11-14H,3-10H2,1-2H3 |
| InChIKey | JZZAIAFHTXSNBH-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |