C13H28N2O2S — CID 103902206
N-(2-tert-butylsulfonylethyl)-1,3-dimethylpiperidin-4-amine (PubChem CID 103902206) has the molecular formula C13H28N2O2S and a molecular weight of 276.45 g/mol. Its IUPAC name is N-(2-tert-butylsulfonylethyl)-1,3-dimethylpiperidin-4-amine.
| Compound Name | N-(2-tert-butylsulfonylethyl)-1,3-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 103902206 |
| Molecular Formula | C13H28N2O2S |
| Molecular Weight | 276.45 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | N-(2-tert-butylsulfonylethyl)-1,3-dimethylpiperidin-4-amine |
| SMILES | CC1CN(C)CCC1NCCS(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C13H28N2O2S/c1-11-10-15(5)8-6-12(11)14-7-9-18(16,17)13(2,3)4/h11-12,14H,6-10H2,1-5H3 |
| InChIKey | HLYMKVWEUHHABK-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.45 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |