C10H23N3O2S — CID 114503363
3-amino-N-(1,3-dimethylpiperidin-4-yl)propane-1-sulfonamide (PubChem CID 114503363) has the molecular formula C10H23N3O2S and a molecular weight of 249.38 g/mol. Its IUPAC name is 3-amino-N-(1,3-dimethylpiperidin-4-yl)propane-1-sulfonamide.
| Compound Name | 3-amino-N-(1,3-dimethylpiperidin-4-yl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 114503363 |
| Molecular Formula | C10H23N3O2S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 3-amino-N-(1,3-dimethylpiperidin-4-yl)propane-1-sulfonamide |
| SMILES | CC1CN(C)CCC1NS(=O)(=O)CCCN |
| InChI | InChI=1S/C10H23N3O2S/c1-9-8-13(2)6-4-10(9)12-16(14,15)7-3-5-11/h9-10,12H,3-8,11H2,1-2H3 |
| InChIKey | RLQBVQCEORJCCI-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |