2-[(1,3-dimethylpiperidin-4-yl)sulfamoyl]acetic acid

C9H18N2O4S — CID 114503113

IUPAC2-[(1,3-dimethylpiperidin-4-yl)sulfamoyl]acetic acid
SMILESCC1CN(C)CCC1NS(=O)(=O)CC(=O)O
InChIInChI=1S/C9H18N2O4S/c1-7-5-11(2)4-3-8(7)10-16(14,15)6-9(12)13/h7-8,10H,3-6H2,1-2H3,(H,12,13)
InChIKeyKHGUZMVNKDFJNS-UHFFFAOYSA-N
MW250.32 g/mol
LogP-0.67
Rot. Bonds4

About 2-[(1,3-dimethylpiperidin-4-yl)sulfamoyl]acetic acid

2-[(1,3-dimethylpiperidin-4-yl)sulfamoyl]acetic acid (PubChem CID 114503113) has the molecular formula C9H18N2O4S and a molecular weight of 250.32 g/mol. Its IUPAC name is 2-[(1,3-dimethylpiperidin-4-yl)sulfamoyl]acetic acid.

Molecular Properties

Compound Name2-[(1,3-dimethylpiperidin-4-yl)sulfamoyl]acetic acid
PubChem CID114503113
Molecular FormulaC9H18N2O4S
Molecular Weight250.32 g/mol
Exact Mass250.10
IUPAC Name2-[(1,3-dimethylpiperidin-4-yl)sulfamoyl]acetic acid
SMILESCC1CN(C)CCC1NS(=O)(=O)CC(=O)O
InChIInChI=1S/C9H18N2O4S/c1-7-5-11(2)4-3-8(7)10-16(14,15)6-9(12)13/h7-8,10H,3-6H2,1-2H3,(H,12,13)
InChIKeyKHGUZMVNKDFJNS-UHFFFAOYSA-N
XLogP-0.67
TPSA86.71 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500250.32
LogP ≤ 5-0.67
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-[(1,3-dimethylpiperidin-4-yl)sulfamoyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(1,3-dimethylpiperidin-4-yl)sulfamoyl]acetic acid?
The IUPAC name of 2-[(1,3-dimethylpiperidin-4-yl)sulfamoyl]acetic acid (CID 114503113) is 2-[(1,3-dimethylpiperidin-4-yl)sulfamoyl]acetic acid.
What is the SMILES notation for 2-[(1,3-dimethylpiperidin-4-yl)sulfamoyl]acetic acid?
The canonical SMILES for 2-[(1,3-dimethylpiperidin-4-yl)sulfamoyl]acetic acid is CC1CN(C)CCC1NS(=O)(=O)CC(=O)O.
What is the InChIKey of 2-[(1,3-dimethylpiperidin-4-yl)sulfamoyl]acetic acid?
The InChIKey is KHGUZMVNKDFJNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O4S/c1-7-5-11(2)4-3-8(7)10-16(14,15)6-9(12)13/h7-8,10H,3-6H2,1-2H3,(H,12,13).
What are the key properties of 2-[(1,3-dimethylpiperidin-4-yl)sulfamoyl]acetic acid?
2-[(1,3-dimethylpiperidin-4-yl)sulfamoyl]acetic acid has a molecular weight of 250.32 g/mol, XLogP of -0.67, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1,3-dimethylpiperidin-4-yl)sulfamoyl]acetic acid is sourced from PubChem (CID 114503113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).