C9H18N2O4S — CID 114503113
2-[(1,3-dimethylpiperidin-4-yl)sulfamoyl]acetic acid (PubChem CID 114503113) has the molecular formula C9H18N2O4S and a molecular weight of 250.32 g/mol. Its IUPAC name is 2-[(1,3-dimethylpiperidin-4-yl)sulfamoyl]acetic acid.
| Compound Name | 2-[(1,3-dimethylpiperidin-4-yl)sulfamoyl]acetic acid |
|---|---|
| PubChem CID | 114503113 |
| Molecular Formula | C9H18N2O4S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 2-[(1,3-dimethylpiperidin-4-yl)sulfamoyl]acetic acid |
| SMILES | CC1CN(C)CCC1NS(=O)(=O)CC(=O)O |
| InChI | InChI=1S/C9H18N2O4S/c1-7-5-11(2)4-3-8(7)10-16(14,15)6-9(12)13/h7-8,10H,3-6H2,1-2H3,(H,12,13) |
| InChIKey | KHGUZMVNKDFJNS-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |