C14H23NO — CID 62774498
2-(propylamino)-1-(2,4,6-trimethylphenyl)ethanol (PubChem CID 62774498) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is 2-(propylamino)-1-(2,4,6-trimethylphenyl)ethanol.
| Compound Name | 2-(propylamino)-1-(2,4,6-trimethylphenyl)ethanol |
|---|---|
| PubChem CID | 62774498 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 2-(propylamino)-1-(2,4,6-trimethylphenyl)ethanol |
| SMILES | CCCNCC(O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C14H23NO/c1-5-6-15-9-13(16)14-11(3)7-10(2)8-12(14)4/h7-8,13,15-16H,5-6,9H2,1-4H3 |
| InChIKey | LYLPKMHBZPFNHH-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|