C16H26FN — CID 106882869
3-(2-fluoro-4,6-dimethylphenyl)-2-methyl-N-propylbutan-1-amine (PubChem CID 106882869) has the molecular formula C16H26FN and a molecular weight of 251.39 g/mol. Its IUPAC name is 3-(2-fluoro-4,6-dimethylphenyl)-2-methyl-N-propylbutan-1-amine.
| Compound Name | 3-(2-fluoro-4,6-dimethylphenyl)-2-methyl-N-propylbutan-1-amine |
|---|---|
| PubChem CID | 106882869 |
| Molecular Formula | C16H26FN |
| Molecular Weight | 251.39 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | 3-(2-fluoro-4,6-dimethylphenyl)-2-methyl-N-propylbutan-1-amine |
| SMILES | CCCNCC(C)C(C)c1c(C)cc(C)cc1F |
| InChI | InChI=1S/C16H26FN/c1-6-7-18-10-13(4)14(5)16-12(3)8-11(2)9-15(16)17/h8-9,13-14,18H,6-7,10H2,1-5H3 |
| InChIKey | JAIQYPYGDUAUKQ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.39 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|