C14H22FN — CID 106881356
N-ethyl-1-(2-fluoro-4,6-dimethylphenyl)butan-1-amine (PubChem CID 106881356) has the molecular formula C14H22FN and a molecular weight of 223.34 g/mol. Its IUPAC name is N-ethyl-1-(2-fluoro-4,6-dimethylphenyl)butan-1-amine.
| Compound Name | N-ethyl-1-(2-fluoro-4,6-dimethylphenyl)butan-1-amine |
|---|---|
| PubChem CID | 106881356 |
| Molecular Formula | C14H22FN |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | N-ethyl-1-(2-fluoro-4,6-dimethylphenyl)butan-1-amine |
| SMILES | CCCC(NCC)c1c(C)cc(C)cc1F |
| InChI | InChI=1S/C14H22FN/c1-5-7-13(16-6-2)14-11(4)8-10(3)9-12(14)15/h8-9,13,16H,5-7H2,1-4H3 |
| InChIKey | ADDMDEXGKPGXPE-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |