C13H13NaO6 — CID 23667840
sodium (Z)-1-(2,6-dimethoxyphenyl)-4-methoxy-3,4-dioxobut-1-en-1-olate (PubChem CID 23667840) has the molecular formula C13H13NaO6 and a molecular weight of 288.23 g/mol. Its IUPAC name is sodium (Z)-1-(2,6-dimethoxyphenyl)-4-methoxy-3,4-dioxobut-1-en-1-olate.
| Compound Name | sodium (Z)-1-(2,6-dimethoxyphenyl)-4-methoxy-3,4-dioxobut-1-en-1-olate |
|---|---|
| PubChem CID | 23667840 |
| Molecular Formula | C13H13NaO6 |
| Molecular Weight | 288.23 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | sodium (Z)-1-(2,6-dimethoxyphenyl)-4-methoxy-3,4-dioxobut-1-en-1-olate |
| SMILES | COC(=O)C(=O)/C=C(\[O-])c1c(OC)cccc1OC.[Na+] |
| InChI | InChI=1S/C13H14O6.Na/c1-17-10-5-4-6-11(18-2)12(10)8(14)7-9(15)13(16)19-3;/h4-7,14H,1-3H3;/q;+1/p-1/b8-7-; |
| InChIKey | KWWQTXAQDQYNPV-CFYXSCKTSA-M |
| XLogP | -2.85 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.23 |
| LogP ≤ 5 | -2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|