C11H8NO6- — CID 4089070
4-methoxy-1-(3-nitrophenyl)-3,4-dioxobut-1-en-1-olate (PubChem CID 4089070) has the molecular formula C11H8NO6- and a molecular weight of 250.19 g/mol. Its IUPAC name is 4-methoxy-1-(3-nitrophenyl)-3,4-dioxobut-1-en-1-olate.
| Compound Name | 4-methoxy-1-(3-nitrophenyl)-3,4-dioxobut-1-en-1-olate |
|---|---|
| PubChem CID | 4089070 |
| Molecular Formula | C11H8NO6- |
| Molecular Weight | 250.19 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | 4-methoxy-1-(3-nitrophenyl)-3,4-dioxobut-1-en-1-olate |
| SMILES | COC(=O)C(=O)C=C([O-])c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H9NO6/c1-18-11(15)10(14)6-9(13)7-3-2-4-8(5-7)12(16)17/h2-6,13H,1H3/p-1 |
| InChIKey | NCGPYGZQDNIHJP-UHFFFAOYSA-M |
| XLogP | 0.04 |
| TPSA | 109.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.19 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|