C11H9O4- — CID 51411176
4-methoxy-3,4-dioxo-1-phenylbut-1-en-1-olate (PubChem CID 51411176) has the molecular formula C11H9O4- and a molecular weight of 205.19 g/mol. Its IUPAC name is 4-methoxy-3,4-dioxo-1-phenylbut-1-en-1-olate.
| Compound Name | 4-methoxy-3,4-dioxo-1-phenylbut-1-en-1-olate |
|---|---|
| PubChem CID | 51411176 |
| Molecular Formula | C11H9O4- |
| Molecular Weight | 205.19 g/mol |
| Exact Mass | 205.05 |
| IUPAC Name | 4-methoxy-3,4-dioxo-1-phenylbut-1-en-1-olate |
| SMILES | COC(=O)C(=O)C=C([O-])c1ccccc1 |
| InChI | InChI=1S/C11H10O4/c1-15-11(14)10(13)7-9(12)8-5-3-2-4-6-8/h2-7,12H,1H3/p-1 |
| InChIKey | RLRGETOSWKYBHX-UHFFFAOYSA-M |
| XLogP | 0.13 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.19 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|