C11H8ClO4- — CID 86311368
(Z)-1-(4-chlorophenyl)-4-methoxy-3,4-dioxobut-1-en-1-olate (PubChem CID 86311368) has the molecular formula C11H8ClO4- and a molecular weight of 239.63 g/mol. Its IUPAC name is (Z)-1-(4-chlorophenyl)-4-methoxy-3,4-dioxobut-1-en-1-olate.
| Compound Name | (Z)-1-(4-chlorophenyl)-4-methoxy-3,4-dioxobut-1-en-1-olate |
|---|---|
| PubChem CID | 86311368 |
| Molecular Formula | C11H8ClO4- |
| Molecular Weight | 239.63 g/mol |
| Exact Mass | 239.01 |
| IUPAC Name | (Z)-1-(4-chlorophenyl)-4-methoxy-3,4-dioxobut-1-en-1-olate |
| SMILES | COC(=O)C(=O)/C=C(\[O-])c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H9ClO4/c1-16-11(15)10(14)6-9(13)7-2-4-8(12)5-3-7/h2-6,13H,1H3/p-1/b9-6- |
| InChIKey | MZFJPAFGPHWXGR-TWGQIWQCSA-M |
| XLogP | 0.78 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.63 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|