C14H19NO5 — CID 174726129
methyl (Z)-2-(2,6-dimethoxyphenyl)-3-(2-hydroxyethylamino)prop-2-enoate (PubChem CID 174726129) has the molecular formula C14H19NO5 and a molecular weight of 281.31 g/mol. Its IUPAC name is methyl (Z)-2-(2,6-dimethoxyphenyl)-3-(2-hydroxyethylamino)prop-2-enoate.
| Compound Name | methyl (Z)-2-(2,6-dimethoxyphenyl)-3-(2-hydroxyethylamino)prop-2-enoate |
|---|---|
| PubChem CID | 174726129 |
| Molecular Formula | C14H19NO5 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | methyl (Z)-2-(2,6-dimethoxyphenyl)-3-(2-hydroxyethylamino)prop-2-enoate |
| SMILES | COC(=O)/C(=C\NCCO)c1c(OC)cccc1OC |
| InChI | InChI=1S/C14H19NO5/c1-18-11-5-4-6-12(19-2)13(11)10(14(17)20-3)9-15-7-8-16/h4-6,9,15-16H,7-8H2,1-3H3/b10-9- |
| InChIKey | GRXLQKPOLWDQFW-KTKRTIGZSA-N |
| XLogP | 0.80 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|