C13H19NO5 — CID 66171373
N-(2,3-dihydroxy-2-methylpropyl)-2,6-dimethoxybenzamide (PubChem CID 66171373) has the molecular formula C13H19NO5 and a molecular weight of 269.30 g/mol. Its IUPAC name is N-(2,3-dihydroxy-2-methylpropyl)-2,6-dimethoxybenzamide.
| Compound Name | N-(2,3-dihydroxy-2-methylpropyl)-2,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 66171373 |
| Molecular Formula | C13H19NO5 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | N-(2,3-dihydroxy-2-methylpropyl)-2,6-dimethoxybenzamide |
| SMILES | COc1cccc(OC)c1C(=O)NCC(C)(O)CO |
| InChI | InChI=1S/C13H19NO5/c1-13(17,8-15)7-14-12(16)11-9(18-2)5-4-6-10(11)19-3/h4-6,15,17H,7-8H2,1-3H3,(H,14,16) |
| InChIKey | CYDDFAQYEQYUSX-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |