About (Z)-3-cyclopenta-2,4-dien-1-ylidene-1-(4-iodophenyl)prop-1-en-1-ol
(Z)-3-cyclopenta-2,4-dien-1-ylidene-1-(4-iodophenyl)prop-1-en-1-ol (PubChem CID 139234487) has the molecular formula C14H11IO
and a molecular weight of 322.15 g/mol. Its IUPAC name is (Z)-3-cyclopenta-2,4-dien-1-ylidene-1-(4-iodophenyl)prop-1-en-1-ol.
Molecular Properties
| Compound Name | (Z)-3-cyclopenta-2,4-dien-1-ylidene-1-(4-iodophenyl)prop-1-en-1-ol |
| PubChem CID | 139234487 |
| Molecular Formula | C14H11IO |
| Molecular Weight | 322.15 g/mol |
| Exact Mass | 321.99 |
| IUPAC Name | (Z)-3-cyclopenta-2,4-dien-1-ylidene-1-(4-iodophenyl)prop-1-en-1-ol |
| SMILES | O/C(=C\C=C1C=CC=C1)c1ccc(I)cc1 |
| InChI | InChI=1S/C14H11IO/c15-13-8-6-12(7-9-13)14(16)10-5-11-3-1-2-4-11/h1-10,16H/b14-10- |
| InChIKey | ZXHWSLVQZIPJIV-UVTDQMKNSA-N |
| XLogP | 4.24 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.15 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-cyclopenta-2,4-dien-1-ylidene-1-(4-iodophenyl)prop-1-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-cyclopenta-2,4-dien-1-ylidene-1-(4-iodophenyl)prop-1-en-1-ol?
The IUPAC name of (Z)-3-cyclopenta-2,4-dien-1-ylidene-1-(4-iodophenyl)prop-1-en-1-ol (CID 139234487) is (Z)-3-cyclopenta-2,4-dien-1-ylidene-1-(4-iodophenyl)prop-1-en-1-ol.
What is the SMILES notation for (Z)-3-cyclopenta-2,4-dien-1-ylidene-1-(4-iodophenyl)prop-1-en-1-ol?
The canonical SMILES for (Z)-3-cyclopenta-2,4-dien-1-ylidene-1-(4-iodophenyl)prop-1-en-1-ol is O/C(=C\C=C1C=CC=C1)c1ccc(I)cc1.
What is the InChIKey of (Z)-3-cyclopenta-2,4-dien-1-ylidene-1-(4-iodophenyl)prop-1-en-1-ol?
The InChIKey is ZXHWSLVQZIPJIV-UVTDQMKNSA-N. The full InChI is InChI=1S/C14H11IO/c15-13-8-6-12(7-9-13)14(16)10-5-11-3-1-2-4-11/h1-10,16H/b14-10-.
What are the key properties of (Z)-3-cyclopenta-2,4-dien-1-ylidene-1-(4-iodophenyl)prop-1-en-1-ol?
(Z)-3-cyclopenta-2,4-dien-1-ylidene-1-(4-iodophenyl)prop-1-en-1-ol has a molecular weight of 322.15 g/mol, XLogP of 4.24, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-cyclopenta-2,4-dien-1-ylidene-1-(4-iodophenyl)prop-1-en-1-ol is sourced from PubChem (CID 139234487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).