C14H11IO — CID 139234487
(Z)-3-cyclopenta-2,4-dien-1-ylidene-1-(4-iodophenyl)prop-1-en-1-ol (PubChem CID 139234487) has the molecular formula C14H11IO and a molecular weight of 322.15 g/mol. Its IUPAC name is (Z)-3-cyclopenta-2,4-dien-1-ylidene-1-(4-iodophenyl)prop-1-en-1-ol.
| Compound Name | (Z)-3-cyclopenta-2,4-dien-1-ylidene-1-(4-iodophenyl)prop-1-en-1-ol |
|---|---|
| PubChem CID | 139234487 |
| Molecular Formula | C14H11IO |
| Molecular Weight | 322.15 g/mol |
| Exact Mass | 321.99 |
| IUPAC Name | (Z)-3-cyclopenta-2,4-dien-1-ylidene-1-(4-iodophenyl)prop-1-en-1-ol |
| SMILES | O/C(=C\C=C1C=CC=C1)c1ccc(I)cc1 |
| InChI | InChI=1S/C14H11IO/c15-13-8-6-12(7-9-13)14(16)10-5-11-3-1-2-4-11/h1-10,16H/b14-10- |
| InChIKey | ZXHWSLVQZIPJIV-UVTDQMKNSA-N |
| XLogP | 4.24 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.15 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|