C32H51BrFeO — CID 131722944
6-bromo-1-(2,3,4,5-tetratert-butylcyclopenta-1,3-dien-1-yl)hexan-2-one;cyclopenta-1,3-diene;iron(2+) (PubChem CID 131722944) has the molecular formula C32H51BrFeO and a molecular weight of 587.51 g/mol. Its IUPAC name is 6-bromo-1-(2,3,4,5-tetratert-butylcyclopenta-1,3-dien-1-yl)hexan-2-one;cyclopenta-1,3-diene;iron(2+).
| Compound Name | 6-bromo-1-(2,3,4,5-tetratert-butylcyclopenta-1,3-dien-1-yl)hexan-2-one;cyclopenta-1,3-diene;iron(2+) |
|---|---|
| PubChem CID | 131722944 |
| Molecular Formula | C32H51BrFeO |
| Molecular Weight | 587.51 g/mol |
| Exact Mass | 586.25 |
| IUPAC Name | 6-bromo-1-(2,3,4,5-tetratert-butylcyclopenta-1,3-dien-1-yl)hexan-2-one;cyclopenta-1,3-diene;iron(2+) |
| SMILES | CC(C)(C)c1c(C(C)(C)C)c(C(C)(C)C)[c-](C(C)(C)C)c1CC(=O)CCCCBr.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C27H46BrO.C5H5.Fe/c1-24(2,3)20-19(17-18(29)15-13-14-16-28)21(25(4,5)6)23(27(10,11)12)22(20)26(7,8)9;1-2-4-5-3-1;/h13-17H2,1-12H3;1-5H;/q2*-1;+2 |
| InChIKey | IQGQAXDNVNOLFW-UHFFFAOYSA-N |
| XLogP | 9.68 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.51 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|