C39H58Br2O4S2 — CID 91142516
[4-[2-[4-(4-bromobutanoyloxy)-3,5-ditert-butyl-2-sulfanylphenyl]propan-2-yl]-2,6-ditert-butyl-3-sulfanylphenyl] 4-bromobutanoate (PubChem CID 91142516) has the molecular formula C39H58Br2O4S2 and a molecular weight of 814.83 g/mol. Its IUPAC name is [4-[2-[4-(4-bromobutanoyloxy)-3,5-ditert-butyl-2-sulfanylphenyl]propan-2-yl]-2,6-ditert-butyl-3-sulfanylphenyl] 4-bromobutanoate.
| Compound Name | [4-[2-[4-(4-bromobutanoyloxy)-3,5-ditert-butyl-2-sulfanylphenyl]propan-2-yl]-2,6-ditert-butyl-3-sulfanylphenyl] 4-bromobutanoate |
|---|---|
| PubChem CID | 91142516 |
| Molecular Formula | C39H58Br2O4S2 |
| Molecular Weight | 814.83 g/mol |
| Exact Mass | 812.21 |
| IUPAC Name | [4-[2-[4-(4-bromobutanoyloxy)-3,5-ditert-butyl-2-sulfanylphenyl]propan-2-yl]-2,6-ditert-butyl-3-sulfanylphenyl] 4-bromobutanoate |
| SMILES | CC(C)(C)c1cc(C(C)(C)c2cc(C(C)(C)C)c(OC(=O)CCCBr)c(C(C)(C)C)c2S)c(S)c(C(C)(C)C)c1OC(=O)CCCBr |
| InChI | InChI=1S/C39H58Br2O4S2/c1-35(2,3)23-21-25(33(46)29(37(7,8)9)31(23)44-27(42)17-15-19-40)39(13,14)26-22-24(36(4,5)6)32(45-28(43)18-16-20-41)30(34(26)47)38(10,11)12/h21-22,46-47H,15-20H2,1-14H3 |
| InChIKey | HWZPUIATIQRWOW-UHFFFAOYSA-N |
| XLogP | 11.94 |
| TPSA | 52.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.83 |
| LogP ≤ 5 | 11.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|