C17H26O3S — CID 57462960
[2,6-ditert-butyl-4-(sulfanylmethyl)phenyl] 2-hydroxyacetate (PubChem CID 57462960) has the molecular formula C17H26O3S and a molecular weight of 310.46 g/mol. Its IUPAC name is [2,6-ditert-butyl-4-(sulfanylmethyl)phenyl] 2-hydroxyacetate.
| Compound Name | [2,6-ditert-butyl-4-(sulfanylmethyl)phenyl] 2-hydroxyacetate |
|---|---|
| PubChem CID | 57462960 |
| Molecular Formula | C17H26O3S |
| Molecular Weight | 310.46 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | [2,6-ditert-butyl-4-(sulfanylmethyl)phenyl] 2-hydroxyacetate |
| SMILES | CC(C)(C)c1cc(CS)cc(C(C)(C)C)c1OC(=O)CO |
| InChI | InChI=1S/C17H26O3S/c1-16(2,3)12-7-11(10-21)8-13(17(4,5)6)15(12)20-14(19)9-18/h7-8,18,21H,9-10H2,1-6H3 |
| InChIKey | HUQAUXCFEJKAGW-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.46 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|