C33H48O5Se2 — CID 25095085
5-[2,6-ditert-butyl-4-[(3,5-ditert-butyl-4-hydroxyphenyl)diselanyl]phenoxy]-5-oxopentanoic acid (PubChem CID 25095085) has the molecular formula C33H48O5Se2 and a molecular weight of 682.66 g/mol. Its IUPAC name is 5-[2,6-ditert-butyl-4-[(3,5-ditert-butyl-4-hydroxyphenyl)diselanyl]phenoxy]-5-oxopentanoic acid.
| Compound Name | 5-[2,6-ditert-butyl-4-[(3,5-ditert-butyl-4-hydroxyphenyl)diselanyl]phenoxy]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 25095085 |
| Molecular Formula | C33H48O5Se2 |
| Molecular Weight | 682.66 g/mol |
| Exact Mass | 684.18 |
| IUPAC Name | 5-[2,6-ditert-butyl-4-[(3,5-ditert-butyl-4-hydroxyphenyl)diselanyl]phenoxy]-5-oxopentanoic acid |
| SMILES | CC(C)(C)c1cc([Se][Se]c2cc(C(C)(C)C)c(OC(=O)CCCC(=O)O)c(C(C)(C)C)c2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C33H48O5Se2/c1-30(2,3)22-16-20(17-23(28(22)37)31(4,5)6)39-40-21-18-24(32(7,8)9)29(25(19-21)33(10,11)12)38-27(36)15-13-14-26(34)35/h16-19,37H,13-15H2,1-12H3,(H,34,35) |
| InChIKey | VNZJXTOMMDRPDT-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.66 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|