C36H54O4S2 — CID 142183235
5-[2,6-ditert-butyl-4-[2-(3,5-ditert-butylphenyl)sulfanylpropan-2-ylsulfanyl]phenoxy]-5-oxopentanoic acid (PubChem CID 142183235) has the molecular formula C36H54O4S2 and a molecular weight of 614.96 g/mol. Its IUPAC name is 5-[2,6-ditert-butyl-4-[2-(3,5-ditert-butylphenyl)sulfanylpropan-2-ylsulfanyl]phenoxy]-5-oxopentanoic acid.
| Compound Name | 5-[2,6-ditert-butyl-4-[2-(3,5-ditert-butylphenyl)sulfanylpropan-2-ylsulfanyl]phenoxy]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 142183235 |
| Molecular Formula | C36H54O4S2 |
| Molecular Weight | 614.96 g/mol |
| Exact Mass | 614.35 |
| IUPAC Name | 5-[2,6-ditert-butyl-4-[2-(3,5-ditert-butylphenyl)sulfanylpropan-2-ylsulfanyl]phenoxy]-5-oxopentanoic acid |
| SMILES | CC(C)(Sc1cc(C(C)(C)C)cc(C(C)(C)C)c1)Sc1cc(C(C)(C)C)c(OC(=O)CCCC(=O)O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C36H54O4S2/c1-32(2,3)23-18-24(33(4,5)6)20-25(19-23)41-36(13,14)42-26-21-27(34(7,8)9)31(28(22-26)35(10,11)12)40-30(39)17-15-16-29(37)38/h18-22H,15-17H2,1-14H3,(H,37,38) |
| InChIKey | AGXOPIBQMIIDGZ-UHFFFAOYSA-N |
| XLogP | 10.66 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.96 |
| LogP ≤ 5 | 10.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|