C36H55NaO6S2 — CID 142183270
sodium [4-[2,6-ditert-butyl-4-[1-(3,5-ditert-butylphenyl)-2-methylpropan-2-yl]sulfanylphenoxy]-4-oxobutyl] sulfate (PubChem CID 142183270) has the molecular formula C36H55NaO6S2 and a molecular weight of 670.95 g/mol. Its IUPAC name is sodium [4-[2,6-ditert-butyl-4-[1-(3,5-ditert-butylphenyl)-2-methylpropan-2-yl]sulfanylphenoxy]-4-oxobutyl] sulfate.
| Compound Name | sodium [4-[2,6-ditert-butyl-4-[1-(3,5-ditert-butylphenyl)-2-methylpropan-2-yl]sulfanylphenoxy]-4-oxobutyl] sulfate |
|---|---|
| PubChem CID | 142183270 |
| Molecular Formula | C36H55NaO6S2 |
| Molecular Weight | 670.95 g/mol |
| Exact Mass | 670.33 |
| IUPAC Name | sodium [4-[2,6-ditert-butyl-4-[1-(3,5-ditert-butylphenyl)-2-methylpropan-2-yl]sulfanylphenoxy]-4-oxobutyl] sulfate |
| SMILES | CC(C)(Cc1cc(C(C)(C)C)cc(C(C)(C)C)c1)Sc1cc(C(C)(C)C)c(OC(=O)CCCOS(=O)(=O)[O-])c(C(C)(C)C)c1.[Na+] |
| InChI | InChI=1S/C36H56O6S2.Na/c1-32(2,3)25-18-24(19-26(20-25)33(4,5)6)23-36(13,14)43-27-21-28(34(7,8)9)31(29(22-27)35(10,11)12)42-30(37)16-15-17-41-44(38,39)40;/h18-22H,15-17,23H2,1-14H3,(H,38,39,40);/q;+1/p-1 |
| InChIKey | KVLUZDZUVQBVIB-UHFFFAOYSA-M |
| XLogP | 6.16 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.95 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|