C38H59NaO2S2 — CID 142219447
sodium 5-[2,6-ditert-butyl-4-[1-(3,5-ditert-butylphenyl)propan-2-ylsulfanyl]phenoxy]hex-5-enyl-methylidene-oxido-λ4-sulfane (PubChem CID 142219447) has the molecular formula C38H59NaO2S2 and a molecular weight of 635.01 g/mol. Its IUPAC name is sodium 5-[2,6-ditert-butyl-4-[1-(3,5-ditert-butylphenyl)propan-2-ylsulfanyl]phenoxy]hex-5-enyl-methylidene-oxido-λ4-sulfane.
| Compound Name | sodium 5-[2,6-ditert-butyl-4-[1-(3,5-ditert-butylphenyl)propan-2-ylsulfanyl]phenoxy]hex-5-enyl-methylidene-oxido-λ4-sulfane |
|---|---|
| PubChem CID | 142219447 |
| Molecular Formula | C38H59NaO2S2 |
| Molecular Weight | 635.01 g/mol |
| Exact Mass | 634.39 |
| IUPAC Name | sodium 5-[2,6-ditert-butyl-4-[1-(3,5-ditert-butylphenyl)propan-2-ylsulfanyl]phenoxy]hex-5-enyl-methylidene-oxido-λ4-sulfane |
| SMILES | C=C(CCCCS(=C)[O-])Oc1c(C(C)(C)C)cc(SC(C)Cc2cc(C(C)(C)C)cc(C(C)(C)C)c2)cc1C(C)(C)C.[Na+] |
| InChI | InChI=1S/C38H59O2S2.Na/c1-26(18-16-17-19-42(15)39)40-34-32(37(9,10)11)24-31(25-33(34)38(12,13)14)41-27(2)20-28-21-29(35(3,4)5)23-30(22-28)36(6,7)8;/h21-25,27H,1,15-20H2,2-14H3;/q-1;+1 |
| InChIKey | QTIPQENVZFEGJS-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.01 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|