C34H54O3S2 — CID 143139858
2,6-ditert-butyl-4-[1-[3,5-ditert-butyl-4-(4-hydroxybutoxy)phenyl]sulfanylethylsulfanyl]phenol (PubChem CID 143139858) has the molecular formula C34H54O3S2 and a molecular weight of 574.94 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[1-[3,5-ditert-butyl-4-(4-hydroxybutoxy)phenyl]sulfanylethylsulfanyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[1-[3,5-ditert-butyl-4-(4-hydroxybutoxy)phenyl]sulfanylethylsulfanyl]phenol |
|---|---|
| PubChem CID | 143139858 |
| Molecular Formula | C34H54O3S2 |
| Molecular Weight | 574.94 g/mol |
| Exact Mass | 574.35 |
| IUPAC Name | 2,6-ditert-butyl-4-[1-[3,5-ditert-butyl-4-(4-hydroxybutoxy)phenyl]sulfanylethylsulfanyl]phenol |
| SMILES | CC(Sc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)Sc1cc(C(C)(C)C)c(OCCCCO)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C34H54O3S2/c1-22(38-23-18-25(31(2,3)4)29(36)26(19-23)32(5,6)7)39-24-20-27(33(8,9)10)30(37-17-15-14-16-35)28(21-24)34(11,12)13/h18-22,35-36H,14-17H2,1-13H3 |
| InChIKey | SRRCSOSVAFIEGS-UHFFFAOYSA-N |
| XLogP | 9.96 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.94 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|