C36H58O6S2 — CID 91470428
(2R,3S,4R)-5-[2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropan-2-ylsulfanyl]phenoxy]pentane-1,2,3,4-tetrol (PubChem CID 91470428) has the molecular formula C36H58O6S2 and a molecular weight of 650.99 g/mol. Its IUPAC name is (2R,3S,4R)-5-[2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropan-2-ylsulfanyl]phenoxy]pentane-1,2,3,4-tetrol.
| Compound Name | (2R,3S,4R)-5-[2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropan-2-ylsulfanyl]phenoxy]pentane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 91470428 |
| Molecular Formula | C36H58O6S2 |
| Molecular Weight | 650.99 g/mol |
| Exact Mass | 650.37 |
| IUPAC Name | (2R,3S,4R)-5-[2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropan-2-ylsulfanyl]phenoxy]pentane-1,2,3,4-tetrol |
| SMILES | CC(C)(Sc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)Sc1cc(C(C)(C)C)c(OC[C@@H](O)[C@@H](O)[C@H](O)CO)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C36H58O6S2/c1-32(2,3)23-15-21(16-24(29(23)40)33(4,5)6)43-36(13,14)44-22-17-25(34(7,8)9)31(26(18-22)35(10,11)12)42-20-28(39)30(41)27(38)19-37/h15-18,27-28,30,37-41H,19-20H2,1-14H3/t27-,28-,30+/m1/s1 |
| InChIKey | ASAYUFGYRPATLB-QVKOCQLISA-N |
| XLogP | 7.66 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.99 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|