C43H68S — CID 142091626
acetylene;1,3-ditert-butyl-5-[1-(3,5-ditert-butylphenyl)-2-methylpropan-2-yl]sulfanyl-2-(4,6-dimethylhept-6-enyl)benzene (PubChem CID 142091626) has the molecular formula C43H68S and a molecular weight of 617.08 g/mol. Its IUPAC name is acetylene;1,3-ditert-butyl-5-[1-(3,5-ditert-butylphenyl)-2-methylpropan-2-yl]sulfanyl-2-(4,6-dimethylhept-6-enyl)benzene.
| Compound Name | acetylene;1,3-ditert-butyl-5-[1-(3,5-ditert-butylphenyl)-2-methylpropan-2-yl]sulfanyl-2-(4,6-dimethylhept-6-enyl)benzene |
|---|---|
| PubChem CID | 142091626 |
| Molecular Formula | C43H68S |
| Molecular Weight | 617.08 g/mol |
| Exact Mass | 616.50 |
| IUPAC Name | acetylene;1,3-ditert-butyl-5-[1-(3,5-ditert-butylphenyl)-2-methylpropan-2-yl]sulfanyl-2-(4,6-dimethylhept-6-enyl)benzene |
| SMILES | C#C.C=C(C)CC(C)CCCc1c(C(C)(C)C)cc(SC(C)(C)Cc2cc(C(C)(C)C)cc(C(C)(C)C)c2)cc1C(C)(C)C |
| InChI | InChI=1S/C41H66S.C2H2/c1-28(2)21-29(3)19-18-20-34-35(39(10,11)12)25-33(26-36(34)40(13,14)15)42-41(16,17)27-30-22-31(37(4,5)6)24-32(23-30)38(7,8)9;1-2/h22-26,29H,1,18-21,27H2,2-17H3;1-2H |
| InChIKey | GRNCJOUESRMPAC-UHFFFAOYSA-N |
| XLogP | 13.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.08 |
| LogP ≤ 5 | 13.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|