C43H76 — CID 123939132
1-tert-butyl-3-(2,3,3,5,5,6,8-heptamethylnon-8-en-2-yl)-5-(2,3,3,5,5,6,6,8-octamethylnon-8-en-2-yl)benzene (PubChem CID 123939132) has the molecular formula C43H76 and a molecular weight of 593.08 g/mol. Its IUPAC name is 1-tert-butyl-3-(2,3,3,5,5,6,8-heptamethylnon-8-en-2-yl)-5-(2,3,3,5,5,6,6,8-octamethylnon-8-en-2-yl)benzene.
| Compound Name | 1-tert-butyl-3-(2,3,3,5,5,6,8-heptamethylnon-8-en-2-yl)-5-(2,3,3,5,5,6,6,8-octamethylnon-8-en-2-yl)benzene |
|---|---|
| PubChem CID | 123939132 |
| Molecular Formula | C43H76 |
| Molecular Weight | 593.08 g/mol |
| Exact Mass | 592.59 |
| IUPAC Name | 1-tert-butyl-3-(2,3,3,5,5,6,8-heptamethylnon-8-en-2-yl)-5-(2,3,3,5,5,6,6,8-octamethylnon-8-en-2-yl)benzene |
| SMILES | C=C(C)CC(C)C(C)(C)CC(C)(C)C(C)(C)c1cc(C(C)(C)C)cc(C(C)(C)C(C)(C)CC(C)(C)C(C)(C)CC(=C)C)c1 |
| InChI | InChI=1S/C43H76/c1-30(2)23-32(5)37(9,10)28-40(15,16)42(19,20)34-24-33(36(6,7)8)25-35(26-34)43(21,22)41(17,18)29-39(13,14)38(11,12)27-31(3)4/h24-26,32H,1,3,23,27-29H2,2,4-22H3 |
| InChIKey | NIBNHRBBTWKOGM-UHFFFAOYSA-N |
| XLogP | 14.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.08 |
| LogP ≤ 5 | 14.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|