C24H44 — CID 166463875
1,3-ditert-butyl-2-methyl-5-(3-methylbut-3-enyl)benzene;ethane (PubChem CID 166463875) has the molecular formula C24H44 and a molecular weight of 332.62 g/mol. Its IUPAC name is 1,3-ditert-butyl-2-methyl-5-(3-methylbut-3-enyl)benzene;ethane.
| Compound Name | 1,3-ditert-butyl-2-methyl-5-(3-methylbut-3-enyl)benzene;ethane |
|---|---|
| PubChem CID | 166463875 |
| Molecular Formula | C24H44 |
| Molecular Weight | 332.62 g/mol |
| Exact Mass | 332.34 |
| IUPAC Name | 1,3-ditert-butyl-2-methyl-5-(3-methylbut-3-enyl)benzene;ethane |
| SMILES | C=C(C)CCc1cc(C(C)(C)C)c(C)c(C(C)(C)C)c1.CC.CC |
| InChI | InChI=1S/C20H32.2C2H6/c1-14(2)10-11-16-12-17(19(4,5)6)15(3)18(13-16)20(7,8)9;2*1-2/h12-13H,1,10-11H2,2-9H3;2*1-2H3 |
| InChIKey | CIHKOWZXSWYAAM-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.62 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|