About 1-methyl-3,5-bis(3-methylbut-3-enyl)benzene
1-methyl-3,5-bis(3-methylbut-3-enyl)benzene (PubChem CID 599502) has the molecular formula C17H24
and a molecular weight of 228.38 g/mol. Its IUPAC name is 1-methyl-3,5-bis(3-methylbut-3-enyl)benzene.
Molecular Properties
| Compound Name | 1-methyl-3,5-bis(3-methylbut-3-enyl)benzene |
| PubChem CID | 599502 |
| Molecular Formula | C17H24 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.19 |
| IUPAC Name | 1-methyl-3,5-bis(3-methylbut-3-enyl)benzene |
| SMILES | C=C(C)CCc1cc(C)cc(CCC(=C)C)c1 |
| InChI | InChI=1S/C17H24/c1-13(2)6-8-16-10-15(5)11-17(12-16)9-7-14(3)4/h10-12H,1,3,6-9H2,2,4-5H3 |
| InChIKey | ZDATUOSTZOHMBC-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-3,5-bis(3-methylbut-3-enyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3,5-bis(3-methylbut-3-enyl)benzene?
The IUPAC name of 1-methyl-3,5-bis(3-methylbut-3-enyl)benzene (CID 599502) is 1-methyl-3,5-bis(3-methylbut-3-enyl)benzene.
What is the SMILES notation for 1-methyl-3,5-bis(3-methylbut-3-enyl)benzene?
The canonical SMILES for 1-methyl-3,5-bis(3-methylbut-3-enyl)benzene is C=C(C)CCc1cc(C)cc(CCC(=C)C)c1.
What is the InChIKey of 1-methyl-3,5-bis(3-methylbut-3-enyl)benzene?
The InChIKey is ZDATUOSTZOHMBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24/c1-13(2)6-8-16-10-15(5)11-17(12-16)9-7-14(3)4/h10-12H,1,3,6-9H2,2,4-5H3.
What are the key properties of 1-methyl-3,5-bis(3-methylbut-3-enyl)benzene?
1-methyl-3,5-bis(3-methylbut-3-enyl)benzene has a molecular weight of 228.38 g/mol, XLogP of 5.01, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3,5-bis(3-methylbut-3-enyl)benzene is sourced from PubChem (CID 599502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).