C21H36O2S — CID 159740767
methane;2-sulfanylethyl 3-(3,5-ditert-butyl-4-methylphenyl)propanoate (PubChem CID 159740767) has the molecular formula C21H36O2S and a molecular weight of 352.58 g/mol. Its IUPAC name is methane;2-sulfanylethyl 3-(3,5-ditert-butyl-4-methylphenyl)propanoate.
| Compound Name | methane;2-sulfanylethyl 3-(3,5-ditert-butyl-4-methylphenyl)propanoate |
|---|---|
| PubChem CID | 159740767 |
| Molecular Formula | C21H36O2S |
| Molecular Weight | 352.58 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | methane;2-sulfanylethyl 3-(3,5-ditert-butyl-4-methylphenyl)propanoate |
| SMILES | C.Cc1c(C(C)(C)C)cc(CCC(=O)OCCS)cc1C(C)(C)C |
| InChI | InChI=1S/C20H32O2S.CH4/c1-14-16(19(2,3)4)12-15(13-17(14)20(5,6)7)8-9-18(21)22-10-11-23;/h12-13,23H,8-11H2,1-7H3;1H4 |
| InChIKey | NCKRTMHDGAAQNR-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.58 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|