C25H38 — CID 143676893
1-tert-butyl-3-(3,8-dimethylidenedec-9-enyl)-5-propan-2-ylbenzene (PubChem CID 143676893) has the molecular formula C25H38 and a molecular weight of 338.58 g/mol. Its IUPAC name is 1-tert-butyl-3-(3,8-dimethylidenedec-9-enyl)-5-propan-2-ylbenzene.
| Compound Name | 1-tert-butyl-3-(3,8-dimethylidenedec-9-enyl)-5-propan-2-ylbenzene |
|---|---|
| PubChem CID | 143676893 |
| Molecular Formula | C25H38 |
| Molecular Weight | 338.58 g/mol |
| Exact Mass | 338.30 |
| IUPAC Name | 1-tert-butyl-3-(3,8-dimethylidenedec-9-enyl)-5-propan-2-ylbenzene |
| SMILES | C=CC(=C)CCCCC(=C)CCc1cc(C(C)C)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C25H38/c1-9-20(4)12-10-11-13-21(5)14-15-22-16-23(19(2)3)18-24(17-22)25(6,7)8/h9,16-19H,1,4-5,10-15H2,2-3,6-8H3 |
| InChIKey | FECXEBJCGVGFHG-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.58 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|