C35H61N — CID 146359719
1-[3,5-bis(3-methylidenedodecyl)phenyl]-N,N-dimethylmethanamine (PubChem CID 146359719) has the molecular formula C35H61N and a molecular weight of 495.88 g/mol. Its IUPAC name is 1-[3,5-bis(3-methylidenedodecyl)phenyl]-N,N-dimethylmethanamine.
| Compound Name | 1-[3,5-bis(3-methylidenedodecyl)phenyl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 146359719 |
| Molecular Formula | C35H61N |
| Molecular Weight | 495.88 g/mol |
| Exact Mass | 495.48 |
| IUPAC Name | 1-[3,5-bis(3-methylidenedodecyl)phenyl]-N,N-dimethylmethanamine |
| SMILES | C=C(CCCCCCCCC)CCc1cc(CCC(=C)CCCCCCCCC)cc(CN(C)C)c1 |
| InChI | InChI=1S/C35H61N/c1-7-9-11-13-15-17-19-21-31(3)23-25-33-27-34(29-35(28-33)30-36(5)6)26-24-32(4)22-20-18-16-14-12-10-8-2/h27-29H,3-4,7-26,30H2,1-2,5-6H3 |
| InChIKey | YOTFCNUFIAXFJG-UHFFFAOYSA-N |
| XLogP | 11.01 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.88 |
| LogP ≤ 5 | 11.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|