C50H89NO2 — CID 139438415
1-[3-[(dimethylamino)methyl]-5-[(Z)-14-methyl-3-methylidenenonadec-11-enyl]phenoxy]-4-octyldodecan-2-one (PubChem CID 139438415) has the molecular formula C50H89NO2 and a molecular weight of 736.27 g/mol. Its IUPAC name is 1-[3-[(dimethylamino)methyl]-5-[(Z)-14-methyl-3-methylidenenonadec-11-enyl]phenoxy]-4-octyldodecan-2-one.
| Compound Name | 1-[3-[(dimethylamino)methyl]-5-[(Z)-14-methyl-3-methylidenenonadec-11-enyl]phenoxy]-4-octyldodecan-2-one |
|---|---|
| PubChem CID | 139438415 |
| Molecular Formula | C50H89NO2 |
| Molecular Weight | 736.27 g/mol |
| Exact Mass | 735.69 |
| IUPAC Name | 1-[3-[(dimethylamino)methyl]-5-[(Z)-14-methyl-3-methylidenenonadec-11-enyl]phenoxy]-4-octyldodecan-2-one |
| SMILES | C=C(CCCCCCC/C=C\CC(C)CCCCC)CCc1cc(CN(C)C)cc(OCC(=O)CC(CCCCCCCC)CCCCCCCC)c1 |
| InChI | InChI=1S/C50H89NO2/c1-8-11-14-16-24-29-34-46(35-30-25-17-15-12-9-2)39-49(52)43-53-50-40-47(38-48(41-50)42-51(6)7)37-36-45(5)33-28-23-21-19-18-20-22-27-32-44(4)31-26-13-10-3/h22,27,38,40-41,44,46H,5,8-21,23-26,28-37,39,42-43H2,1-4,6-7H3/b27-22- |
| InChIKey | QANJPCKEYULUEE-QYQHSDTDSA-N |
| XLogP | 15.59 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.27 |
| LogP ≤ 5 | 15.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|