C52H89NO7 — CID 140929805
3-[3-(dimethylcarbamoyl)-5-[3-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropoxy]phenoxy]propyl 3-octylundecanoate (PubChem CID 140929805) has the molecular formula C52H89NO7 and a molecular weight of 840.28 g/mol. Its IUPAC name is 3-[3-(dimethylcarbamoyl)-5-[3-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropoxy]phenoxy]propyl 3-octylundecanoate.
| Compound Name | 3-[3-(dimethylcarbamoyl)-5-[3-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropoxy]phenoxy]propyl 3-octylundecanoate |
|---|---|
| PubChem CID | 140929805 |
| Molecular Formula | C52H89NO7 |
| Molecular Weight | 840.28 g/mol |
| Exact Mass | 839.66 |
| IUPAC Name | 3-[3-(dimethylcarbamoyl)-5-[3-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropoxy]phenoxy]propyl 3-octylundecanoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCCCOc1cc(OCCCOC(=O)CC(CCCCCCCC)CCCCCCCC)cc(C(=O)N(C)C)c1 |
| InChI | InChI=1S/C52H89NO7/c1-6-9-12-15-18-19-20-21-22-23-24-25-26-29-32-37-50(54)59-40-33-38-57-48-43-47(52(56)53(4)5)44-49(45-48)58-39-34-41-60-51(55)42-46(35-30-27-16-13-10-7-2)36-31-28-17-14-11-8-3/h18-19,21-22,43-46H,6-17,20,23-42H2,1-5H3/b19-18-,22-21- |
| InChIKey | IMCPZVYMAMUBKF-VYEFPUSRSA-N |
| XLogP | 14.33 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 840.28 |
| LogP ≤ 5 | 14.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|