C19H31NOS — CID 83938578
3-(3,5-ditert-butyl-4-methoxyphenyl)-2-methylpropanethioamide (PubChem CID 83938578) has the molecular formula C19H31NOS and a molecular weight of 321.53 g/mol. Its IUPAC name is 3-(3,5-ditert-butyl-4-methoxyphenyl)-2-methylpropanethioamide.
| Compound Name | 3-(3,5-ditert-butyl-4-methoxyphenyl)-2-methylpropanethioamide |
|---|---|
| PubChem CID | 83938578 |
| Molecular Formula | C19H31NOS |
| Molecular Weight | 321.53 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | 3-(3,5-ditert-butyl-4-methoxyphenyl)-2-methylpropanethioamide |
| SMILES | COc1c(C(C)(C)C)cc(CC(C)C(N)=S)cc1C(C)(C)C |
| InChI | InChI=1S/C19H31NOS/c1-12(17(20)22)9-13-10-14(18(2,3)4)16(21-8)15(11-13)19(5,6)7/h10-12H,9H2,1-8H3,(H2,20,22) |
| InChIKey | UVKWQTSVAJJRSY-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.53 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|