C16H25BrO — CID 11987316
11-bromo-1-cyclopenta-2,4-dien-1-ylundecan-1-one (PubChem CID 11987316) has the molecular formula C16H25BrO and a molecular weight of 313.28 g/mol. Its IUPAC name is 11-bromo-1-cyclopenta-2,4-dien-1-ylundecan-1-one.
| Compound Name | 11-bromo-1-cyclopenta-2,4-dien-1-ylundecan-1-one |
|---|---|
| PubChem CID | 11987316 |
| Molecular Formula | C16H25BrO |
| Molecular Weight | 313.28 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 11-bromo-1-cyclopenta-2,4-dien-1-ylundecan-1-one |
| SMILES | O=C(CCCCCCCCCCBr)C1C=CC=C1 |
| InChI | InChI=1S/C16H25BrO/c17-14-10-6-4-2-1-3-5-7-13-16(18)15-11-8-9-12-15/h8-9,11-12,15H,1-7,10,13-14H2 |
| InChIKey | ANYQFAPKESBKJT-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.28 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|