About 11-bromo-1-cyclopenta-2,4-dien-1-ylundecan-1-one
11-bromo-1-cyclopenta-2,4-dien-1-ylundecan-1-one (PubChem CID 11987316) has the molecular formula C16H25BrO
and a molecular weight of 313.28 g/mol. Its IUPAC name is 11-bromo-1-cyclopenta-2,4-dien-1-ylundecan-1-one.
Molecular Properties
| Compound Name | 11-bromo-1-cyclopenta-2,4-dien-1-ylundecan-1-one |
| PubChem CID | 11987316 |
| Molecular Formula | C16H25BrO |
| Molecular Weight | 313.28 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 11-bromo-1-cyclopenta-2,4-dien-1-ylundecan-1-one |
| SMILES | O=C(CCCCCCCCCCBr)C1C=CC=C1 |
| InChI | InChI=1S/C16H25BrO/c17-14-10-6-4-2-1-3-5-7-13-16(18)15-11-8-9-12-15/h8-9,11-12,15H,1-7,10,13-14H2 |
| InChIKey | ANYQFAPKESBKJT-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 313.28 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 11-bromo-1-cyclopenta-2,4-dien-1-ylundecan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-bromo-1-cyclopenta-2,4-dien-1-ylundecan-1-one?
The IUPAC name of 11-bromo-1-cyclopenta-2,4-dien-1-ylundecan-1-one (CID 11987316) is 11-bromo-1-cyclopenta-2,4-dien-1-ylundecan-1-one.
What is the SMILES notation for 11-bromo-1-cyclopenta-2,4-dien-1-ylundecan-1-one?
The canonical SMILES for 11-bromo-1-cyclopenta-2,4-dien-1-ylundecan-1-one is O=C(CCCCCCCCCCBr)C1C=CC=C1.
What is the InChIKey of 11-bromo-1-cyclopenta-2,4-dien-1-ylundecan-1-one?
The InChIKey is ANYQFAPKESBKJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25BrO/c17-14-10-6-4-2-1-3-5-7-13-16(18)15-11-8-9-12-15/h8-9,11-12,15H,1-7,10,13-14H2.
What are the key properties of 11-bromo-1-cyclopenta-2,4-dien-1-ylundecan-1-one?
11-bromo-1-cyclopenta-2,4-dien-1-ylundecan-1-one has a molecular weight of 313.28 g/mol, XLogP of 5.20, 11 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 11-bromo-1-cyclopenta-2,4-dien-1-ylundecan-1-one is sourced from PubChem (CID 11987316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).