C12H14FeO-2 — CID 73169264
cyclopenta-1,3-diene;2-cyclopenta-1,3-dien-1-ylethanol;iron (PubChem CID 73169264) has the molecular formula C12H14FeO-2 and a molecular weight of 230.09 g/mol. Its IUPAC name is cyclopenta-1,3-diene;2-cyclopenta-1,3-dien-1-ylethanol;iron.
| Compound Name | cyclopenta-1,3-diene;2-cyclopenta-1,3-dien-1-ylethanol;iron |
|---|---|
| PubChem CID | 73169264 |
| Molecular Formula | C12H14FeO-2 |
| Molecular Weight | 230.09 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | cyclopenta-1,3-diene;2-cyclopenta-1,3-dien-1-ylethanol;iron |
| SMILES | OCCc1ccc[cH-]1.[Fe].c1cc[cH-]c1 |
| InChI | InChI=1S/C7H9O.C5H5.Fe/c8-6-5-7-3-1-2-4-7;1-2-4-5-3-1;/h1-4,8H,5-6H2;1-5H;/q2*-1; |
| InChIKey | BOZRCRIPXMZNKI-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.09 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|